About 1-bromo-2,3-dimethoxycyclohexa-1,3-diene
1-bromo-2,3-dimethoxycyclohexa-1,3-diene (PubChem CID 18357837) has the molecular formula C8H11BrO2
and a molecular weight of 219.08 g/mol. Its IUPAC name is 1-bromo-2,3-dimethoxycyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 1-bromo-2,3-dimethoxycyclohexa-1,3-diene |
| PubChem CID | 18357837 |
| Molecular Formula | C8H11BrO2 |
| Molecular Weight | 219.08 g/mol |
| Exact Mass | 217.99 |
| IUPAC Name | 1-bromo-2,3-dimethoxycyclohexa-1,3-diene |
| SMILES | COC1=CCCC(Br)=C1OC |
| InChI | InChI=1S/C8H11BrO2/c1-10-7-5-3-4-6(9)8(7)11-2/h5H,3-4H2,1-2H3 |
| InChIKey | UHZHHPBDZSYOIG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.08 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-bromo-2,3-dimethoxycyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2,3-dimethoxycyclohexa-1,3-diene?
The IUPAC name of 1-bromo-2,3-dimethoxycyclohexa-1,3-diene (CID 18357837) is 1-bromo-2,3-dimethoxycyclohexa-1,3-diene.
What is the SMILES notation for 1-bromo-2,3-dimethoxycyclohexa-1,3-diene?
The canonical SMILES for 1-bromo-2,3-dimethoxycyclohexa-1,3-diene is COC1=CCCC(Br)=C1OC.
What is the InChIKey of 1-bromo-2,3-dimethoxycyclohexa-1,3-diene?
The InChIKey is UHZHHPBDZSYOIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11BrO2/c1-10-7-5-3-4-6(9)8(7)11-2/h5H,3-4H2,1-2H3.
What are the key properties of 1-bromo-2,3-dimethoxycyclohexa-1,3-diene?
1-bromo-2,3-dimethoxycyclohexa-1,3-diene has a molecular weight of 219.08 g/mol, XLogP of 2.56, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2,3-dimethoxycyclohexa-1,3-diene is sourced from PubChem (CID 18357837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).