C25H28O2 — CID 18357913
2-methyl-4-[3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-ynyl]benzoic acid (PubChem CID 18357913) has the molecular formula C25H28O2 and a molecular weight of 360.50 g/mol. Its IUPAC name is 2-methyl-4-[3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-ynyl]benzoic acid.
| Compound Name | 2-methyl-4-[3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-ynyl]benzoic acid |
|---|---|
| PubChem CID | 18357913 |
| Molecular Formula | C25H28O2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | 2-methyl-4-[3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-ynyl]benzoic acid |
| SMILES | Cc1cc(C#CCc2ccc3c(c2)C(C)(C)CCC3(C)C)ccc1C(=O)O |
| InChI | InChI=1S/C25H28O2/c1-17-15-18(9-11-20(17)23(26)27)7-6-8-19-10-12-21-22(16-19)25(4,5)14-13-24(21,2)3/h9-12,15-16H,8,13-14H2,1-5H3,(H,26,27) |
| InChIKey | XHHJYZIGLXQXMR-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|