About 5-(dithiolan-3-yl)-1-(1,3-thiazolidin-3-yl)pentan-1-one
5-(dithiolan-3-yl)-1-(1,3-thiazolidin-3-yl)pentan-1-one (PubChem CID 18357980) has the molecular formula C11H19NOS3
and a molecular weight of 277.48 g/mol. Its IUPAC name is 5-(dithiolan-3-yl)-1-(1,3-thiazolidin-3-yl)pentan-1-one.
Molecular Properties
| Compound Name | 5-(dithiolan-3-yl)-1-(1,3-thiazolidin-3-yl)pentan-1-one |
| PubChem CID | 18357980 |
| Molecular Formula | C11H19NOS3 |
| Molecular Weight | 277.48 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 5-(dithiolan-3-yl)-1-(1,3-thiazolidin-3-yl)pentan-1-one |
| SMILES | O=C(CCCCC1CCSS1)N1CCSC1 |
| InChI | InChI=1S/C11H19NOS3/c13-11(12-6-8-14-9-12)4-2-1-3-10-5-7-15-16-10/h10H,1-9H2 |
| InChIKey | LOBBJORWILYJJD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 5-(dithiolan-3-yl)-1-(1,3-thiazolidin-3-yl)pentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(dithiolan-3-yl)-1-(1,3-thiazolidin-3-yl)pentan-1-one?
The IUPAC name of 5-(dithiolan-3-yl)-1-(1,3-thiazolidin-3-yl)pentan-1-one (CID 18357980) is 5-(dithiolan-3-yl)-1-(1,3-thiazolidin-3-yl)pentan-1-one.
What is the SMILES notation for 5-(dithiolan-3-yl)-1-(1,3-thiazolidin-3-yl)pentan-1-one?
The canonical SMILES for 5-(dithiolan-3-yl)-1-(1,3-thiazolidin-3-yl)pentan-1-one is O=C(CCCCC1CCSS1)N1CCSC1.
What is the InChIKey of 5-(dithiolan-3-yl)-1-(1,3-thiazolidin-3-yl)pentan-1-one?
The InChIKey is LOBBJORWILYJJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NOS3/c13-11(12-6-8-14-9-12)4-2-1-3-10-5-7-15-16-10/h10H,1-9H2.
What are the key properties of 5-(dithiolan-3-yl)-1-(1,3-thiazolidin-3-yl)pentan-1-one?
5-(dithiolan-3-yl)-1-(1,3-thiazolidin-3-yl)pentan-1-one has a molecular weight of 277.48 g/mol, XLogP of 3.23, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(dithiolan-3-yl)-1-(1,3-thiazolidin-3-yl)pentan-1-one is sourced from PubChem (CID 18357980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).