C36H42O6 — CID 18358270
2,5-bis[(4-methylphenyl)methoxy]-1,6-bis(phenylmethoxy)hexane-3,4-diol (PubChem CID 18358270) has the molecular formula C36H42O6 and a molecular weight of 570.73 g/mol. Its IUPAC name is 2,5-bis[(4-methylphenyl)methoxy]-1,6-bis(phenylmethoxy)hexane-3,4-diol.
| Compound Name | 2,5-bis[(4-methylphenyl)methoxy]-1,6-bis(phenylmethoxy)hexane-3,4-diol |
|---|---|
| PubChem CID | 18358270 |
| Molecular Formula | C36H42O6 |
| Molecular Weight | 570.73 g/mol |
| Exact Mass | 570.30 |
| IUPAC Name | 2,5-bis[(4-methylphenyl)methoxy]-1,6-bis(phenylmethoxy)hexane-3,4-diol |
| SMILES | Cc1ccc(COC(COCc2ccccc2)C(O)C(O)C(COCc2ccccc2)OCc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C36H42O6/c1-27-13-17-31(18-14-27)23-41-33(25-39-21-29-9-5-3-6-10-29)35(37)36(38)34(26-40-22-30-11-7-4-8-12-30)42-24-32-19-15-28(2)16-20-32/h3-20,33-38H,21-26H2,1-2H3 |
| InChIKey | ZYTHJUZGKNLMPV-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.73 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |