C26H44N2O8 — CID 18358472
1,1-bis(2,2,6,6-tetramethylpiperidin-4-yl)butane-1,2,3,4-tetracarboxylic acid (PubChem CID 18358472) has the molecular formula C26H44N2O8 and a molecular weight of 512.64 g/mol. Its IUPAC name is 1,1-bis(2,2,6,6-tetramethylpiperidin-4-yl)butane-1,2,3,4-tetracarboxylic acid.
| Compound Name | 1,1-bis(2,2,6,6-tetramethylpiperidin-4-yl)butane-1,2,3,4-tetracarboxylic acid |
|---|---|
| PubChem CID | 18358472 |
| Molecular Formula | C26H44N2O8 |
| Molecular Weight | 512.64 g/mol |
| Exact Mass | 512.31 |
| IUPAC Name | 1,1-bis(2,2,6,6-tetramethylpiperidin-4-yl)butane-1,2,3,4-tetracarboxylic acid |
| SMILES | CC1(C)CC(C(C(=O)O)(C2CC(C)(C)NC(C)(C)C2)C(C(=O)O)C(CC(=O)O)C(=O)O)CC(C)(C)N1 |
| InChI | InChI=1S/C26H44N2O8/c1-22(2)10-14(11-23(3,4)27-22)26(21(35)36,15-12-24(5,6)28-25(7,8)13-15)18(20(33)34)16(19(31)32)9-17(29)30/h14-16,18,27-28H,9-13H2,1-8H3,(H,29,30)(H,31,32)(H,33,34)(H,35,36) |
| InChIKey | MSIIZELBEHWKOT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 173.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.64 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |