C13H23NO2 — CID 18358639
(E)-2-methyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)prop-2-enoic acid (PubChem CID 18358639) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is (E)-2-methyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)prop-2-enoic acid.
| Compound Name | (E)-2-methyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 18358639 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | (E)-2-methyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)prop-2-enoic acid |
| SMILES | C/C(=C\C1CC(C)(C)NC(C)(C)C1)C(=O)O |
| InChI | InChI=1S/C13H23NO2/c1-9(11(15)16)6-10-7-12(2,3)14-13(4,5)8-10/h6,10,14H,7-8H2,1-5H3,(H,15,16)/b9-6+ |
| InChIKey | MSMFACYBNJFPEY-RMKNXTFCSA-N |
| XLogP | 2.57 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|