About Diethyl-butoxysilane
Diethyl-butoxysilane (PubChem CID 18358687) has the molecular formula C8H19OSi
and a molecular weight of 159.32 g/mol.
Molecular Properties
| Compound Name | Diethyl-butoxysilane |
| PubChem CID | 18358687 |
| Molecular Formula | C8H19OSi |
| Molecular Weight | 159.32 g/mol |
| Exact Mass | 159.12 |
| IUPAC Name | — |
| SMILES | CCCCO[Si](CC)CC |
| InChI | InChI=1S/C8H19OSi/c1-4-7-8-9-10(5-2)6-3/h4-8H2,1-3H3 |
| InChIKey | LNMYNRAVYWJPJN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Diethyl-butoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Diethyl-butoxysilane?
The IUPAC name of Diethyl-butoxysilane (CID 18358687) is not available.
What is the SMILES notation for Diethyl-butoxysilane?
The canonical SMILES for Diethyl-butoxysilane is CCCCO[Si](CC)CC.
What is the InChIKey of Diethyl-butoxysilane?
The InChIKey is LNMYNRAVYWJPJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19OSi/c1-4-7-8-9-10(5-2)6-3/h4-8H2,1-3H3.
What are the key properties of Diethyl-butoxysilane?
Diethyl-butoxysilane has a molecular weight of 159.32 g/mol, XLogP of 2.83, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Diethyl-butoxysilane is sourced from PubChem (CID 18358687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).