C9H12O — CID 18358805
2-prop-2-enylcyclohexa-1,3-dien-1-ol (PubChem CID 18358805) has the molecular formula C9H12O and a molecular weight of 136.19 g/mol. Its IUPAC name is 2-prop-2-enylcyclohexa-1,3-dien-1-ol.
| Compound Name | 2-prop-2-enylcyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 18358805 |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.09 |
| IUPAC Name | 2-prop-2-enylcyclohexa-1,3-dien-1-ol |
| SMILES | C=CCC1=C(O)CCC=C1 |
| InChI | InChI=1S/C9H12O/c1-2-5-8-6-3-4-7-9(8)10/h2-3,6,10H,1,4-5,7H2 |
| InChIKey | DSQHKTXEZSKVRO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|