About [4-(hydroxymethyl)cyclohexyl]methyl 2,2-dicyanoacetate
[4-(hydroxymethyl)cyclohexyl]methyl 2,2-dicyanoacetate (PubChem CID 18358828) has the molecular formula C12H16N2O3
and a molecular weight of 236.27 g/mol. Its IUPAC name is [4-(hydroxymethyl)cyclohexyl]methyl 2,2-dicyanoacetate.
Molecular Properties
| Compound Name | [4-(hydroxymethyl)cyclohexyl]methyl 2,2-dicyanoacetate |
| PubChem CID | 18358828 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | [4-(hydroxymethyl)cyclohexyl]methyl 2,2-dicyanoacetate |
| SMILES | N#CC(C#N)C(=O)OCC1CCC(CO)CC1 |
| InChI | InChI=1S/C12H16N2O3/c13-5-11(6-14)12(16)17-8-10-3-1-9(7-15)2-4-10/h9-11,15H,1-4,7-8H2 |
| InChIKey | YDMKZYIEMMKSRZ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-(hydroxymethyl)cyclohexyl]methyl 2,2-dicyanoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(hydroxymethyl)cyclohexyl]methyl 2,2-dicyanoacetate?
The IUPAC name of [4-(hydroxymethyl)cyclohexyl]methyl 2,2-dicyanoacetate (CID 18358828) is [4-(hydroxymethyl)cyclohexyl]methyl 2,2-dicyanoacetate.
What is the SMILES notation for [4-(hydroxymethyl)cyclohexyl]methyl 2,2-dicyanoacetate?
The canonical SMILES for [4-(hydroxymethyl)cyclohexyl]methyl 2,2-dicyanoacetate is N#CC(C#N)C(=O)OCC1CCC(CO)CC1.
What is the InChIKey of [4-(hydroxymethyl)cyclohexyl]methyl 2,2-dicyanoacetate?
The InChIKey is YDMKZYIEMMKSRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O3/c13-5-11(6-14)12(16)17-8-10-3-1-9(7-15)2-4-10/h9-11,15H,1-4,7-8H2.
What are the key properties of [4-(hydroxymethyl)cyclohexyl]methyl 2,2-dicyanoacetate?
[4-(hydroxymethyl)cyclohexyl]methyl 2,2-dicyanoacetate has a molecular weight of 236.27 g/mol, XLogP of 0.99, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(hydroxymethyl)cyclohexyl]methyl 2,2-dicyanoacetate is sourced from PubChem (CID 18358828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).