C20H21N3O7 — CID 18358843
5-[5-[2-(1,3-dioxoisoindol-2-yl)oxyethyl]-2,4-dioxopyrimidin-1-yl]-2-methylpentanoic acid (PubChem CID 18358843) has the molecular formula C20H21N3O7 and a molecular weight of 415.40 g/mol. Its IUPAC name is 5-[5-[2-(1,3-dioxoisoindol-2-yl)oxyethyl]-2,4-dioxopyrimidin-1-yl]-2-methylpentanoic acid.
| Compound Name | 5-[5-[2-(1,3-dioxoisoindol-2-yl)oxyethyl]-2,4-dioxopyrimidin-1-yl]-2-methylpentanoic acid |
|---|---|
| PubChem CID | 18358843 |
| Molecular Formula | C20H21N3O7 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 5-[5-[2-(1,3-dioxoisoindol-2-yl)oxyethyl]-2,4-dioxopyrimidin-1-yl]-2-methylpentanoic acid |
| SMILES | CC(CCCn1cc(CCON2C(=O)c3ccccc3C2=O)c(=O)[nH]c1=O)C(=O)O |
| InChI | InChI=1S/C20H21N3O7/c1-12(19(27)28)5-4-9-22-11-13(16(24)21-20(22)29)8-10-30-23-17(25)14-6-2-3-7-15(14)18(23)26/h2-3,6-7,11-12H,4-5,8-10H2,1H3,(H,27,28)(H,21,24,29) |
| InChIKey | SKPAGNMAIMMGDL-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 138.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|