About [carboxy(1,3-thiazol-4-yl)methyl]-triphenylazanium
[carboxy(1,3-thiazol-4-yl)methyl]-triphenylazanium (PubChem CID 18359075) has the molecular formula C23H19N2O2S+
and a molecular weight of 387.48 g/mol. Its IUPAC name is [carboxy(1,3-thiazol-4-yl)methyl]-triphenylazanium.
Molecular Properties
| Compound Name | [carboxy(1,3-thiazol-4-yl)methyl]-triphenylazanium |
| PubChem CID | 18359075 |
| Molecular Formula | C23H19N2O2S+ |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | [carboxy(1,3-thiazol-4-yl)methyl]-triphenylazanium |
| SMILES | O=C(O)C(c1cscn1)[N+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H18N2O2S/c26-23(27)22(21-16-28-17-24-21)25(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-17,22H/p+1 |
| InChIKey | HJRZHEWGQHMDBT-UHFFFAOYSA-O |
| XLogP | 5.94 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [carboxy(1,3-thiazol-4-yl)methyl]-triphenylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [carboxy(1,3-thiazol-4-yl)methyl]-triphenylazanium?
The IUPAC name of [carboxy(1,3-thiazol-4-yl)methyl]-triphenylazanium (CID 18359075) is [carboxy(1,3-thiazol-4-yl)methyl]-triphenylazanium.
What is the SMILES notation for [carboxy(1,3-thiazol-4-yl)methyl]-triphenylazanium?
The canonical SMILES for [carboxy(1,3-thiazol-4-yl)methyl]-triphenylazanium is O=C(O)C(c1cscn1)[N+](c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of [carboxy(1,3-thiazol-4-yl)methyl]-triphenylazanium?
The InChIKey is HJRZHEWGQHMDBT-UHFFFAOYSA-O. The full InChI is InChI=1S/C23H18N2O2S/c26-23(27)22(21-16-28-17-24-21)25(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-17,22H/p+1.
What are the key properties of [carboxy(1,3-thiazol-4-yl)methyl]-triphenylazanium?
[carboxy(1,3-thiazol-4-yl)methyl]-triphenylazanium has a molecular weight of 387.48 g/mol, XLogP of 5.94, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [carboxy(1,3-thiazol-4-yl)methyl]-triphenylazanium is sourced from PubChem (CID 18359075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).