About 2,3-dihydroxycyclohexa-1,5-diene-1,4-dicarbonitrile
2,3-dihydroxycyclohexa-1,5-diene-1,4-dicarbonitrile (PubChem CID 18359102) has the molecular formula C8H6N2O2
and a molecular weight of 162.15 g/mol. Its IUPAC name is 2,3-dihydroxycyclohexa-1,5-diene-1,4-dicarbonitrile.
Analyze 2,3-dihydroxycyclohexa-1,5-diene-1,4-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroxycyclohexa-1,5-diene-1,4-dicarbonitrile?
The IUPAC name of 2,3-dihydroxycyclohexa-1,5-diene-1,4-dicarbonitrile (CID 18359102) is 2,3-dihydroxycyclohexa-1,5-diene-1,4-dicarbonitrile.
What is the SMILES notation for 2,3-dihydroxycyclohexa-1,5-diene-1,4-dicarbonitrile?
The canonical SMILES for 2,3-dihydroxycyclohexa-1,5-diene-1,4-dicarbonitrile is N#CC1=C(O)C(O)C(C#N)C=C1.
What is the InChIKey of 2,3-dihydroxycyclohexa-1,5-diene-1,4-dicarbonitrile?
The InChIKey is BIEVWANEOIGJOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O2/c9-3-5-1-2-6(4-10)8(12)7(5)11/h1-2,5,7,11-12H.
What are the key properties of 2,3-dihydroxycyclohexa-1,5-diene-1,4-dicarbonitrile?
2,3-dihydroxycyclohexa-1,5-diene-1,4-dicarbonitrile has a molecular weight of 162.15 g/mol, XLogP of 0.39, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxycyclohexa-1,5-diene-1,4-dicarbonitrile is sourced from PubChem (CID 18359102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).