About 1-(2-methylbutoxy)-4-(4-propan-2-yloxyphenyl)benzene;3-methylideneoxiran-2-one
1-(2-methylbutoxy)-4-(4-propan-2-yloxyphenyl)benzene;3-methylideneoxiran-2-one (PubChem CID 18359394) has the molecular formula C23H28O4
and a molecular weight of 368.47 g/mol. Its IUPAC name is 1-(2-methylbutoxy)-4-(4-propan-2-yloxyphenyl)benzene;3-methylideneoxiran-2-one.
Molecular Properties
| Compound Name | 1-(2-methylbutoxy)-4-(4-propan-2-yloxyphenyl)benzene;3-methylideneoxiran-2-one |
| PubChem CID | 18359394 |
| Molecular Formula | C23H28O4 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 1-(2-methylbutoxy)-4-(4-propan-2-yloxyphenyl)benzene;3-methylideneoxiran-2-one |
| SMILES | C=C1OC1=O.CCC(C)COc1ccc(-c2ccc(OC(C)C)cc2)cc1 |
| InChI | InChI=1S/C20H26O2.C3H2O2/c1-5-16(4)14-21-19-10-6-17(7-11-19)18-8-12-20(13-9-18)22-15(2)3;1-2-3(4)5-2/h6-13,15-16H,5,14H2,1-4H3;1H2 |
| InChIKey | ITYDWVBFLXPTRI-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-methylbutoxy)-4-(4-propan-2-yloxyphenyl)benzene;3-methylideneoxiran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methylbutoxy)-4-(4-propan-2-yloxyphenyl)benzene;3-methylideneoxiran-2-one?
The IUPAC name of 1-(2-methylbutoxy)-4-(4-propan-2-yloxyphenyl)benzene;3-methylideneoxiran-2-one (CID 18359394) is 1-(2-methylbutoxy)-4-(4-propan-2-yloxyphenyl)benzene;3-methylideneoxiran-2-one.
What is the SMILES notation for 1-(2-methylbutoxy)-4-(4-propan-2-yloxyphenyl)benzene;3-methylideneoxiran-2-one?
The canonical SMILES for 1-(2-methylbutoxy)-4-(4-propan-2-yloxyphenyl)benzene;3-methylideneoxiran-2-one is C=C1OC1=O.CCC(C)COc1ccc(-c2ccc(OC(C)C)cc2)cc1.
What is the InChIKey of 1-(2-methylbutoxy)-4-(4-propan-2-yloxyphenyl)benzene;3-methylideneoxiran-2-one?
The InChIKey is ITYDWVBFLXPTRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26O2.C3H2O2/c1-5-16(4)14-21-19-10-6-17(7-11-19)18-8-12-20(13-9-18)22-15(2)3;1-2-3(4)5-2/h6-13,15-16H,5,14H2,1-4H3;1H2.
What are the key properties of 1-(2-methylbutoxy)-4-(4-propan-2-yloxyphenyl)benzene;3-methylideneoxiran-2-one?
1-(2-methylbutoxy)-4-(4-propan-2-yloxyphenyl)benzene;3-methylideneoxiran-2-one has a molecular weight of 368.47 g/mol, XLogP of 5.62, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methylbutoxy)-4-(4-propan-2-yloxyphenyl)benzene;3-methylideneoxiran-2-one is sourced from PubChem (CID 18359394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).