About tetracyclo[6.4.0.02,4.05,7]dodecane
tetracyclo[6.4.0.02,4.05,7]dodecane (PubChem CID 18359650) has the molecular formula C12H18
and a molecular weight of 162.28 g/mol. Its IUPAC name is tetracyclo[6.4.0.02,4.05,7]dodecane.
Molecular Properties
| Compound Name | tetracyclo[6.4.0.02,4.05,7]dodecane |
| PubChem CID | 18359650 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | tetracyclo[6.4.0.02,4.05,7]dodecane |
| SMILES | C1CCC2C(C1)C1CC1C1CC21 |
| InChI | InChI=1S/C12H18/c1-2-4-8-7(3-1)9-5-11(9)12-6-10(8)12/h7-12H,1-6H2 |
| InChIKey | HLWQTFRIRUTOIX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze tetracyclo[6.4.0.02,4.05,7]dodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetracyclo[6.4.0.02,4.05,7]dodecane?
The IUPAC name of tetracyclo[6.4.0.02,4.05,7]dodecane (CID 18359650) is tetracyclo[6.4.0.02,4.05,7]dodecane.
What is the SMILES notation for tetracyclo[6.4.0.02,4.05,7]dodecane?
The canonical SMILES for tetracyclo[6.4.0.02,4.05,7]dodecane is C1CCC2C(C1)C1CC1C1CC21.
What is the InChIKey of tetracyclo[6.4.0.02,4.05,7]dodecane?
The InChIKey is HLWQTFRIRUTOIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18/c1-2-4-8-7(3-1)9-5-11(9)12-6-10(8)12/h7-12H,1-6H2.
What are the key properties of tetracyclo[6.4.0.02,4.05,7]dodecane?
tetracyclo[6.4.0.02,4.05,7]dodecane has a molecular weight of 162.28 g/mol, XLogP of 3.08, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetracyclo[6.4.0.02,4.05,7]dodecane is sourced from PubChem (CID 18359650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).