About 2-(4-chlorophenyl)-3,5-difluoro-4-methyl-6-[3-(trifluoromethyl)phenoxy]pyridine
2-(4-chlorophenyl)-3,5-difluoro-4-methyl-6-[3-(trifluoromethyl)phenoxy]pyridine (PubChem CID 18359739) has the molecular formula C19H11ClF5NO
and a molecular weight of 399.75 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3,5-difluoro-4-methyl-6-[3-(trifluoromethyl)phenoxy]pyridine.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-3,5-difluoro-4-methyl-6-[3-(trifluoromethyl)phenoxy]pyridine |
| PubChem CID | 18359739 |
| Molecular Formula | C19H11ClF5NO |
| Molecular Weight | 399.75 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | 2-(4-chlorophenyl)-3,5-difluoro-4-methyl-6-[3-(trifluoromethyl)phenoxy]pyridine |
| SMILES | Cc1c(F)c(Oc2cccc(C(F)(F)F)c2)nc(-c2ccc(Cl)cc2)c1F |
| InChI | InChI=1S/C19H11ClF5NO/c1-10-15(21)17(11-5-7-13(20)8-6-11)26-18(16(10)22)27-14-4-2-3-12(9-14)19(23,24)25/h2-9H,1H3 |
| InChIKey | SLTQYEXOFLQNBI-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.75 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-chlorophenyl)-3,5-difluoro-4-methyl-6-[3-(trifluoromethyl)phenoxy]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-3,5-difluoro-4-methyl-6-[3-(trifluoromethyl)phenoxy]pyridine?
The IUPAC name of 2-(4-chlorophenyl)-3,5-difluoro-4-methyl-6-[3-(trifluoromethyl)phenoxy]pyridine (CID 18359739) is 2-(4-chlorophenyl)-3,5-difluoro-4-methyl-6-[3-(trifluoromethyl)phenoxy]pyridine.
What is the SMILES notation for 2-(4-chlorophenyl)-3,5-difluoro-4-methyl-6-[3-(trifluoromethyl)phenoxy]pyridine?
The canonical SMILES for 2-(4-chlorophenyl)-3,5-difluoro-4-methyl-6-[3-(trifluoromethyl)phenoxy]pyridine is Cc1c(F)c(Oc2cccc(C(F)(F)F)c2)nc(-c2ccc(Cl)cc2)c1F.
What is the InChIKey of 2-(4-chlorophenyl)-3,5-difluoro-4-methyl-6-[3-(trifluoromethyl)phenoxy]pyridine?
The InChIKey is SLTQYEXOFLQNBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H11ClF5NO/c1-10-15(21)17(11-5-7-13(20)8-6-11)26-18(16(10)22)27-14-4-2-3-12(9-14)19(23,24)25/h2-9H,1H3.
What are the key properties of 2-(4-chlorophenyl)-3,5-difluoro-4-methyl-6-[3-(trifluoromethyl)phenoxy]pyridine?
2-(4-chlorophenyl)-3,5-difluoro-4-methyl-6-[3-(trifluoromethyl)phenoxy]pyridine has a molecular weight of 399.75 g/mol, XLogP of 6.80, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-3,5-difluoro-4-methyl-6-[3-(trifluoromethyl)phenoxy]pyridine is sourced from PubChem (CID 18359739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).