C21H32O6 — CID 18359776
2,3,4,5-tetrakis(prop-2-enoxy)-6-(prop-2-enoxymethyl)oxane (PubChem CID 18359776) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is 2,3,4,5-tetrakis(prop-2-enoxy)-6-(prop-2-enoxymethyl)oxane.
| Compound Name | 2,3,4,5-tetrakis(prop-2-enoxy)-6-(prop-2-enoxymethyl)oxane |
|---|---|
| PubChem CID | 18359776 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 2,3,4,5-tetrakis(prop-2-enoxy)-6-(prop-2-enoxymethyl)oxane |
| SMILES | C=CCOCC1OC(OCC=C)C(OCC=C)C(OCC=C)C1OCC=C |
| InChI | InChI=1S/C21H32O6/c1-6-11-22-16-17-18(23-12-7-2)19(24-13-8-3)20(25-14-9-4)21(27-17)26-15-10-5/h6-10,17-21H,1-5,11-16H2 |
| InChIKey | UCHNNEUPIPRPNU-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|