About (1-cyclohexylcyclohexyl) formate
(1-cyclohexylcyclohexyl) formate (PubChem CID 18360052) has the molecular formula C13H22O2
and a molecular weight of 210.32 g/mol. Its IUPAC name is (1-cyclohexylcyclohexyl) formate.
Molecular Properties
| Compound Name | (1-cyclohexylcyclohexyl) formate |
| PubChem CID | 18360052 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | (1-cyclohexylcyclohexyl) formate |
| SMILES | O=COC1(C2CCCCC2)CCCCC1 |
| InChI | InChI=1S/C13H22O2/c14-11-15-13(9-5-2-6-10-13)12-7-3-1-4-8-12/h11-12H,1-10H2 |
| InChIKey | AZMSSAOXIKHYEZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (1-cyclohexylcyclohexyl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-cyclohexylcyclohexyl) formate?
The IUPAC name of (1-cyclohexylcyclohexyl) formate (CID 18360052) is (1-cyclohexylcyclohexyl) formate.
What is the SMILES notation for (1-cyclohexylcyclohexyl) formate?
The canonical SMILES for (1-cyclohexylcyclohexyl) formate is O=COC1(C2CCCCC2)CCCCC1.
What is the InChIKey of (1-cyclohexylcyclohexyl) formate?
The InChIKey is AZMSSAOXIKHYEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O2/c14-11-15-13(9-5-2-6-10-13)12-7-3-1-4-8-12/h11-12H,1-10H2.
What are the key properties of (1-cyclohexylcyclohexyl) formate?
(1-cyclohexylcyclohexyl) formate has a molecular weight of 210.32 g/mol, XLogP of 3.44, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-cyclohexylcyclohexyl) formate is sourced from PubChem (CID 18360052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).