C19H19F3IN3O2 — CID 18360068
2,3,5-trifluoro-6-(4-iodo-2-methylanilino)-4-(4-methylpiperazin-1-yl)benzoic acid (PubChem CID 18360068) has the molecular formula C19H19F3IN3O2 and a molecular weight of 505.28 g/mol. Its IUPAC name is 2,3,5-trifluoro-6-(4-iodo-2-methylanilino)-4-(4-methylpiperazin-1-yl)benzoic acid.
| Compound Name | 2,3,5-trifluoro-6-(4-iodo-2-methylanilino)-4-(4-methylpiperazin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 18360068 |
| Molecular Formula | C19H19F3IN3O2 |
| Molecular Weight | 505.28 g/mol |
| Exact Mass | 505.05 |
| IUPAC Name | 2,3,5-trifluoro-6-(4-iodo-2-methylanilino)-4-(4-methylpiperazin-1-yl)benzoic acid |
| SMILES | Cc1cc(I)ccc1Nc1c(F)c(N2CCN(C)CC2)c(F)c(F)c1C(=O)O |
| InChI | InChI=1S/C19H19F3IN3O2/c1-10-9-11(23)3-4-12(10)24-17-13(19(27)28)14(20)15(21)18(16(17)22)26-7-5-25(2)6-8-26/h3-4,9,24H,5-8H2,1-2H3,(H,27,28) |
| InChIKey | FFZLCQZGTRSKKN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.28 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|