C31H40F3N3O5 — CID 18360860
3-[7-carbamoyl-5-[2-[2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethylamino]propyl]indol-1-yl]propyl 2-ethylbutanoate (PubChem CID 18360860) has the molecular formula C31H40F3N3O5 and a molecular weight of 591.67 g/mol. Its IUPAC name is 3-[7-carbamoyl-5-[2-[2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethylamino]propyl]indol-1-yl]propyl 2-ethylbutanoate.
| Compound Name | 3-[7-carbamoyl-5-[2-[2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethylamino]propyl]indol-1-yl]propyl 2-ethylbutanoate |
|---|---|
| PubChem CID | 18360860 |
| Molecular Formula | C31H40F3N3O5 |
| Molecular Weight | 591.67 g/mol |
| Exact Mass | 591.29 |
| IUPAC Name | 3-[7-carbamoyl-5-[2-[2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethylamino]propyl]indol-1-yl]propyl 2-ethylbutanoate |
| SMILES | CCC(CC)C(=O)OCCCn1ccc2cc(CC(C)NCCOc3ccccc3OCC(F)(F)F)cc(C(N)=O)c21 |
| InChI | InChI=1S/C31H40F3N3O5/c1-4-23(5-2)30(39)41-15-8-13-37-14-11-24-18-22(19-25(28(24)37)29(35)38)17-21(3)36-12-16-40-26-9-6-7-10-27(26)42-20-31(32,33)34/h6-7,9-11,14,18-19,21,23,36H,4-5,8,12-13,15-17,20H2,1-3H3,(H2,35,38) |
| InChIKey | IKZBISSZVKNVCW-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.67 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|