About 2,2-dinitropropanoic acid
2,2-dinitropropanoic acid (PubChem CID 18360905) has the molecular formula C3H4N2O6
and a molecular weight of 164.07 g/mol. Its IUPAC name is 2,2-dinitropropanoic acid.
Molecular Properties
| Compound Name | 2,2-dinitropropanoic acid |
| PubChem CID | 18360905 |
| Molecular Formula | C3H4N2O6 |
| Molecular Weight | 164.07 g/mol |
| Exact Mass | 164.01 |
| IUPAC Name | 2,2-dinitropropanoic acid |
| SMILES | CC(C(=O)O)([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C3H4N2O6/c1-3(2(6)7,4(8)9)5(10)11/h1H3,(H,6,7) |
| InChIKey | IKXGLGLZHXEECO-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.07 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dinitropropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dinitropropanoic acid?
The IUPAC name of 2,2-dinitropropanoic acid (CID 18360905) is 2,2-dinitropropanoic acid.
What is the SMILES notation for 2,2-dinitropropanoic acid?
The canonical SMILES for 2,2-dinitropropanoic acid is CC(C(=O)O)([N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of 2,2-dinitropropanoic acid?
The InChIKey is IKXGLGLZHXEECO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N2O6/c1-3(2(6)7,4(8)9)5(10)11/h1H3,(H,6,7).
What are the key properties of 2,2-dinitropropanoic acid?
2,2-dinitropropanoic acid has a molecular weight of 164.07 g/mol, XLogP of -0.66, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dinitropropanoic acid is sourced from PubChem (CID 18360905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).