About phenyl propanoate;hydrochloride
phenyl propanoate;hydrochloride (PubChem CID 18360910) has the molecular formula C9H11ClO2
and a molecular weight of 186.64 g/mol. Its IUPAC name is phenyl propanoate;hydrochloride.
Molecular Properties
| Compound Name | phenyl propanoate;hydrochloride |
| PubChem CID | 18360910 |
| Molecular Formula | C9H11ClO2 |
| Molecular Weight | 186.64 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | phenyl propanoate;hydrochloride |
| SMILES | CCC(=O)Oc1ccccc1.Cl |
| InChI | InChI=1S/C9H10O2.ClH/c1-2-9(10)11-8-6-4-3-5-7-8;/h3-7H,2H2,1H3;1H |
| InChIKey | GXLJZLBKWSJXFP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.64 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze phenyl propanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl propanoate;hydrochloride?
The IUPAC name of phenyl propanoate;hydrochloride (CID 18360910) is phenyl propanoate;hydrochloride.
What is the SMILES notation for phenyl propanoate;hydrochloride?
The canonical SMILES for phenyl propanoate;hydrochloride is CCC(=O)Oc1ccccc1.Cl.
What is the InChIKey of phenyl propanoate;hydrochloride?
The InChIKey is GXLJZLBKWSJXFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2.ClH/c1-2-9(10)11-8-6-4-3-5-7-8;/h3-7H,2H2,1H3;1H.
What are the key properties of phenyl propanoate;hydrochloride?
phenyl propanoate;hydrochloride has a molecular weight of 186.64 g/mol, XLogP of 2.42, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl propanoate;hydrochloride is sourced from PubChem (CID 18360910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).