About 2-methylsulfanylbutanoic acid
2-methylsulfanylbutanoic acid (PubChem CID 18361012) has the molecular formula C5H10O2S
and a molecular weight of 134.20 g/mol. Its IUPAC name is 2-methylsulfanylbutanoic acid.
Molecular Properties
| Compound Name | 2-methylsulfanylbutanoic acid |
| PubChem CID | 18361012 |
| Molecular Formula | C5H10O2S |
| Molecular Weight | 134.20 g/mol |
| Exact Mass | 134.04 |
| IUPAC Name | 2-methylsulfanylbutanoic acid |
| SMILES | CCC(SC)C(=O)O |
| InChI | InChI=1S/C5H10O2S/c1-3-4(8-2)5(6)7/h4H,3H2,1-2H3,(H,6,7) |
| InChIKey | IKMGEAMKZUENRW-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.20 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylsulfanylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanylbutanoic acid?
The IUPAC name of 2-methylsulfanylbutanoic acid (CID 18361012) is 2-methylsulfanylbutanoic acid.
What is the SMILES notation for 2-methylsulfanylbutanoic acid?
The canonical SMILES for 2-methylsulfanylbutanoic acid is CCC(SC)C(=O)O.
What is the InChIKey of 2-methylsulfanylbutanoic acid?
The InChIKey is IKMGEAMKZUENRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2S/c1-3-4(8-2)5(6)7/h4H,3H2,1-2H3,(H,6,7).
What are the key properties of 2-methylsulfanylbutanoic acid?
2-methylsulfanylbutanoic acid has a molecular weight of 134.20 g/mol, XLogP of 1.21, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanylbutanoic acid is sourced from PubChem (CID 18361012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).