About butanedithioate
butanedithioate (PubChem CID 18361651) has the molecular formula C4H7S2-
and a molecular weight of 119.23 g/mol. Its IUPAC name is butanedithioate.
Molecular Properties
| Compound Name | butanedithioate |
| PubChem CID | 18361651 |
| Molecular Formula | C4H7S2- |
| Molecular Weight | 119.23 g/mol |
| Exact Mass | 119.00 |
| IUPAC Name | butanedithioate |
| SMILES | CCCC(=S)[S-] |
| InChI | InChI=1S/C4H8S2/c1-2-3-4(5)6/h2-3H2,1H3,(H,5,6)/p-1 |
| InChIKey | BPOPGHPHBCLJOK-UHFFFAOYSA-M |
| XLogP | 1.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze butanedithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanedithioate?
The IUPAC name of butanedithioate (CID 18361651) is butanedithioate.
What is the SMILES notation for butanedithioate?
The canonical SMILES for butanedithioate is CCCC(=S)[S-].
What is the InChIKey of butanedithioate?
The InChIKey is BPOPGHPHBCLJOK-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H8S2/c1-2-3-4(5)6/h2-3H2,1H3,(H,5,6)/p-1.
What are the key properties of butanedithioate?
butanedithioate has a molecular weight of 119.23 g/mol, XLogP of 1.66, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butanedithioate is sourced from PubChem (CID 18361651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).