C17H15N9O — CID 18361817
3-(5-methyl-1,2-oxazol-3-yl)-N-[(1-methyl-1,2,4-triazol-3-yl)methyl]-[1,2,4]triazolo[3,4-a]phthalazin-6-amine (PubChem CID 18361817) has the molecular formula C17H15N9O and a molecular weight of 361.37 g/mol. Its IUPAC name is 3-(5-methyl-1,2-oxazol-3-yl)-N-[(1-methyl-1,2,4-triazol-3-yl)methyl]-[1,2,4]triazolo[3,4-a]phthalazin-6-amine.
| Compound Name | 3-(5-methyl-1,2-oxazol-3-yl)-N-[(1-methyl-1,2,4-triazol-3-yl)methyl]-[1,2,4]triazolo[3,4-a]phthalazin-6-amine |
|---|---|
| PubChem CID | 18361817 |
| Molecular Formula | C17H15N9O |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 3-(5-methyl-1,2-oxazol-3-yl)-N-[(1-methyl-1,2,4-triazol-3-yl)methyl]-[1,2,4]triazolo[3,4-a]phthalazin-6-amine |
| SMILES | Cc1cc(-c2nnc3c4ccccc4c(NCc4ncn(C)n4)nn23)no1 |
| InChI | InChI=1S/C17H15N9O/c1-10-7-13(24-27-10)17-21-20-16-12-6-4-3-5-11(12)15(23-26(16)17)18-8-14-19-9-25(2)22-14/h3-7,9H,8H2,1-2H3,(H,18,23) |
| InChIKey | RIRNGMJMNBSAJS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |