About 3-(2,3,4-triiodophenyl)propane-1,2-diol
3-(2,3,4-triiodophenyl)propane-1,2-diol (PubChem CID 18362181) has the molecular formula C9H9I3O2
and a molecular weight of 529.88 g/mol. Its IUPAC name is 3-(2,3,4-triiodophenyl)propane-1,2-diol.
Molecular Properties
| Compound Name | 3-(2,3,4-triiodophenyl)propane-1,2-diol |
| PubChem CID | 18362181 |
| Molecular Formula | C9H9I3O2 |
| Molecular Weight | 529.88 g/mol |
| Exact Mass | 529.77 |
| IUPAC Name | 3-(2,3,4-triiodophenyl)propane-1,2-diol |
| SMILES | OCC(O)Cc1ccc(I)c(I)c1I |
| InChI | InChI=1S/C9H9I3O2/c10-7-2-1-5(3-6(14)4-13)8(11)9(7)12/h1-2,6,13-14H,3-4H2 |
| InChIKey | WNUUJSRJLHLKTD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 529.88 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,3,4-triiodophenyl)propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3,4-triiodophenyl)propane-1,2-diol?
The IUPAC name of 3-(2,3,4-triiodophenyl)propane-1,2-diol (CID 18362181) is 3-(2,3,4-triiodophenyl)propane-1,2-diol.
What is the SMILES notation for 3-(2,3,4-triiodophenyl)propane-1,2-diol?
The canonical SMILES for 3-(2,3,4-triiodophenyl)propane-1,2-diol is OCC(O)Cc1ccc(I)c(I)c1I.
What is the InChIKey of 3-(2,3,4-triiodophenyl)propane-1,2-diol?
The InChIKey is WNUUJSRJLHLKTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9I3O2/c10-7-2-1-5(3-6(14)4-13)8(11)9(7)12/h1-2,6,13-14H,3-4H2.
What are the key properties of 3-(2,3,4-triiodophenyl)propane-1,2-diol?
3-(2,3,4-triiodophenyl)propane-1,2-diol has a molecular weight of 529.88 g/mol, XLogP of 2.40, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3,4-triiodophenyl)propane-1,2-diol is sourced from PubChem (CID 18362181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).