C9H3F16NO4S — CID 18362322
2-[1,1,2,2,2-pentafluoroethyl(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonyl)amino]acetic acid (PubChem CID 18362322) has the molecular formula C9H3F16NO4S and a molecular weight of 525.16 g/mol. Its IUPAC name is 2-[1,1,2,2,2-pentafluoroethyl(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonyl)amino]acetic acid.
| Compound Name | 2-[1,1,2,2,2-pentafluoroethyl(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonyl)amino]acetic acid |
|---|---|
| PubChem CID | 18362322 |
| Molecular Formula | C9H3F16NO4S |
| Molecular Weight | 525.16 g/mol |
| Exact Mass | 524.95 |
| IUPAC Name | 2-[1,1,2,2,2-pentafluoroethyl(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonyl)amino]acetic acid |
| SMILES | O=C(O)CN(C(F)(F)C(F)(F)F)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H3F16NO4S/c10-3(11,4(12,13)6(16,17)18)5(14,15)9(24,25)31(29,30)26(1-2(27)28)8(22,23)7(19,20)21/h1H2,(H,27,28) |
| InChIKey | HKVLPIROOZECSV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.16 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|