About pyrrolidine-2,5-dione
pyrrolidine-2,5-dione (PubChem CID 18362525) has the molecular formula C8H10N2O4
and a molecular weight of 198.18 g/mol. Its IUPAC name is pyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | pyrrolidine-2,5-dione |
| PubChem CID | 18362525 |
| Molecular Formula | C8H10N2O4 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1.O=C1CCC(=O)N1 |
| InChI | InChI=1S/2C4H5NO2/c2*6-3-1-2-4(7)5-3/h2*1-2H2,(H,5,6,7) |
| InChIKey | YDVMDJMNQSRVIH-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze pyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolidine-2,5-dione?
The IUPAC name of pyrrolidine-2,5-dione (CID 18362525) is pyrrolidine-2,5-dione.
What is the SMILES notation for pyrrolidine-2,5-dione?
The canonical SMILES for pyrrolidine-2,5-dione is O=C1CCC(=O)N1.O=C1CCC(=O)N1.
What is the InChIKey of pyrrolidine-2,5-dione?
The InChIKey is YDVMDJMNQSRVIH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H5NO2/c2*6-3-1-2-4(7)5-3/h2*1-2H2,(H,5,6,7).
What are the key properties of pyrrolidine-2,5-dione?
pyrrolidine-2,5-dione has a molecular weight of 198.18 g/mol, XLogP of -1.15, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolidine-2,5-dione is sourced from PubChem (CID 18362525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).