About 2-hydroxypropanoyl octanoate
2-hydroxypropanoyl octanoate (PubChem CID 18362559) has the molecular formula C11H20O4
and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-hydroxypropanoyl octanoate.
Molecular Properties
| Compound Name | 2-hydroxypropanoyl octanoate |
| PubChem CID | 18362559 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 2-hydroxypropanoyl octanoate |
| SMILES | CCCCCCCC(=O)OC(=O)C(C)O |
| InChI | InChI=1S/C11H20O4/c1-3-4-5-6-7-8-10(13)15-11(14)9(2)12/h9,12H,3-8H2,1-2H3 |
| InChIKey | SPRJWMSXOLZOIO-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxypropanoyl octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypropanoyl octanoate?
The IUPAC name of 2-hydroxypropanoyl octanoate (CID 18362559) is 2-hydroxypropanoyl octanoate.
What is the SMILES notation for 2-hydroxypropanoyl octanoate?
The canonical SMILES for 2-hydroxypropanoyl octanoate is CCCCCCCC(=O)OC(=O)C(C)O.
What is the InChIKey of 2-hydroxypropanoyl octanoate?
The InChIKey is SPRJWMSXOLZOIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O4/c1-3-4-5-6-7-8-10(13)15-11(14)9(2)12/h9,12H,3-8H2,1-2H3.
What are the key properties of 2-hydroxypropanoyl octanoate?
2-hydroxypropanoyl octanoate has a molecular weight of 216.28 g/mol, XLogP of 1.80, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropanoyl octanoate is sourced from PubChem (CID 18362559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).