C16H14 — CID 18362646
tetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),5,7,9,12,14-hexaene (PubChem CID 18362646) has the molecular formula C16H14 and a molecular weight of 206.29 g/mol. Its IUPAC name is tetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),5,7,9,12,14-hexaene.
| Compound Name | tetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),5,7,9,12,14-hexaene |
|---|---|
| PubChem CID | 18362646 |
| Molecular Formula | C16H14 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | tetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),5,7,9,12,14-hexaene |
| SMILES | c1ccc2c(c1)Cc1ccccc1C1CC21 |
| InChI | InChI=1S/C16H14/c1-3-7-13-11(5-1)9-12-6-2-4-8-14(12)16-10-15(13)16/h1-8,15-16H,9-10H2 |
| InChIKey | QNIPMVKBHLRPAG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |