C15H12ClNO4 — CID 18363447
4-[1-[(3-chlorophenyl)methyl]pyrrol-3-yl]-2,4-dioxobutanoic acid (PubChem CID 18363447) has the molecular formula C15H12ClNO4 and a molecular weight of 305.72 g/mol. Its IUPAC name is 4-[1-[(3-chlorophenyl)methyl]pyrrol-3-yl]-2,4-dioxobutanoic acid.
| Compound Name | 4-[1-[(3-chlorophenyl)methyl]pyrrol-3-yl]-2,4-dioxobutanoic acid |
|---|---|
| PubChem CID | 18363447 |
| Molecular Formula | C15H12ClNO4 |
| Molecular Weight | 305.72 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 4-[1-[(3-chlorophenyl)methyl]pyrrol-3-yl]-2,4-dioxobutanoic acid |
| SMILES | O=C(O)C(=O)CC(=O)c1ccn(Cc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C15H12ClNO4/c16-12-3-1-2-10(6-12)8-17-5-4-11(9-17)13(18)7-14(19)15(20)21/h1-6,9H,7-8H2,(H,20,21) |
| InChIKey | OLVBXAJXXHOQCD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.72 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|