C26H46N4O2 — CID 18363587
4-[2-(1-formyl-2,2,6,6-tetramethylpiperidin-4-yl)iminohexylideneamino]-2,2,6,6-tetramethylpiperidine-1-carbaldehyde (PubChem CID 18363587) has the molecular formula C26H46N4O2 and a molecular weight of 446.68 g/mol. Its IUPAC name is 4-[2-(1-formyl-2,2,6,6-tetramethylpiperidin-4-yl)iminohexylideneamino]-2,2,6,6-tetramethylpiperidine-1-carbaldehyde.
| Compound Name | 4-[2-(1-formyl-2,2,6,6-tetramethylpiperidin-4-yl)iminohexylideneamino]-2,2,6,6-tetramethylpiperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 18363587 |
| Molecular Formula | C26H46N4O2 |
| Molecular Weight | 446.68 g/mol |
| Exact Mass | 446.36 |
| IUPAC Name | 4-[2-(1-formyl-2,2,6,6-tetramethylpiperidin-4-yl)iminohexylideneamino]-2,2,6,6-tetramethylpiperidine-1-carbaldehyde |
| SMILES | CCCCC(/C=N/C1CC(C)(C)N(C=O)C(C)(C)C1)=N\C1CC(C)(C)N(C=O)C(C)(C)C1 |
| InChI | InChI=1S/C26H46N4O2/c1-10-11-12-20(28-22-15-25(6,7)30(19-32)26(8,9)16-22)17-27-21-13-23(2,3)29(18-31)24(4,5)14-21/h17-19,21-22H,10-16H2,1-9H3/b27-17+,28-20+ |
| InChIKey | ZUUSRABNAGKGQP-JUZHGAENSA-N |
| XLogP | 5.04 |
| TPSA | 65.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.68 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|