About (2-propylphenyl)methyl acetate
(2-propylphenyl)methyl acetate (PubChem CID 18363688) has the molecular formula C12H16O2
and a molecular weight of 192.26 g/mol. Its IUPAC name is (2-propylphenyl)methyl acetate.
Molecular Properties
| Compound Name | (2-propylphenyl)methyl acetate |
| PubChem CID | 18363688 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | (2-propylphenyl)methyl acetate |
| SMILES | CCCc1ccccc1COC(C)=O |
| InChI | InChI=1S/C12H16O2/c1-3-6-11-7-4-5-8-12(11)9-14-10(2)13/h4-5,7-8H,3,6,9H2,1-2H3 |
| InChIKey | GIPWUJLJHGHBNW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2-propylphenyl)methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-propylphenyl)methyl acetate?
The IUPAC name of (2-propylphenyl)methyl acetate (CID 18363688) is (2-propylphenyl)methyl acetate.
What is the SMILES notation for (2-propylphenyl)methyl acetate?
The canonical SMILES for (2-propylphenyl)methyl acetate is CCCc1ccccc1COC(C)=O.
What is the InChIKey of (2-propylphenyl)methyl acetate?
The InChIKey is GIPWUJLJHGHBNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O2/c1-3-6-11-7-4-5-8-12(11)9-14-10(2)13/h4-5,7-8H,3,6,9H2,1-2H3.
What are the key properties of (2-propylphenyl)methyl acetate?
(2-propylphenyl)methyl acetate has a molecular weight of 192.26 g/mol, XLogP of 2.70, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-propylphenyl)methyl acetate is sourced from PubChem (CID 18363688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).