About 2-iminoethanimidamide
2-iminoethanimidamide (PubChem CID 18363766) has the molecular formula C2H5N3
and a molecular weight of 71.08 g/mol. Its IUPAC name is 2-iminoethanimidamide.
Molecular Properties
| Compound Name | 2-iminoethanimidamide |
| PubChem CID | 18363766 |
| Molecular Formula | C2H5N3 |
| Molecular Weight | 71.08 g/mol |
| Exact Mass | 71.05 |
| IUPAC Name | 2-iminoethanimidamide |
| SMILES | [H]/N=C(N)/C=N/[H] |
| InChI | InChI=1S/C2H5N3/c3-1-2(4)5/h1,3H,(H3,4,5)/b3-1+ |
| InChIKey | VODZKSFXXIWOJO-HNQUOIGGSA-N |
| XLogP | -0.43 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 71.08 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-iminoethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iminoethanimidamide?
The IUPAC name of 2-iminoethanimidamide (CID 18363766) is 2-iminoethanimidamide.
What is the SMILES notation for 2-iminoethanimidamide?
The canonical SMILES for 2-iminoethanimidamide is [H]/N=C(N)/C=N/[H].
What is the InChIKey of 2-iminoethanimidamide?
The InChIKey is VODZKSFXXIWOJO-HNQUOIGGSA-N. The full InChI is InChI=1S/C2H5N3/c3-1-2(4)5/h1,3H,(H3,4,5)/b3-1+.
What are the key properties of 2-iminoethanimidamide?
2-iminoethanimidamide has a molecular weight of 71.08 g/mol, XLogP of -0.43, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iminoethanimidamide is sourced from PubChem (CID 18363766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).