C9H18N6O — CID 18363803
6-[(4,6-diamino-1,3,5-triazin-2-yl)amino]hexan-1-ol (PubChem CID 18363803) has the molecular formula C9H18N6O and a molecular weight of 226.28 g/mol. Its IUPAC name is 6-[(4,6-diamino-1,3,5-triazin-2-yl)amino]hexan-1-ol.
| Compound Name | 6-[(4,6-diamino-1,3,5-triazin-2-yl)amino]hexan-1-ol |
|---|---|
| PubChem CID | 18363803 |
| Molecular Formula | C9H18N6O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 6-[(4,6-diamino-1,3,5-triazin-2-yl)amino]hexan-1-ol |
| SMILES | Nc1nc(N)nc(NCCCCCCO)n1 |
| InChI | InChI=1S/C9H18N6O/c10-7-13-8(11)15-9(14-7)12-5-3-1-2-4-6-16/h16H,1-6H2,(H5,10,11,12,13,14,15) |
| InChIKey | ZYEPUQANSQPRIQ-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 122.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|