C6H12N6O — CID 18363804
3-[(4,6-diamino-1,3,5-triazin-2-yl)amino]propan-1-ol (PubChem CID 18363804) has the molecular formula C6H12N6O and a molecular weight of 184.20 g/mol. Its IUPAC name is 3-[(4,6-diamino-1,3,5-triazin-2-yl)amino]propan-1-ol.
| Compound Name | 3-[(4,6-diamino-1,3,5-triazin-2-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 18363804 |
| Molecular Formula | C6H12N6O |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 3-[(4,6-diamino-1,3,5-triazin-2-yl)amino]propan-1-ol |
| SMILES | Nc1nc(N)nc(NCCCO)n1 |
| InChI | InChI=1S/C6H12N6O/c7-4-10-5(8)12-6(11-4)9-2-1-3-13/h13H,1-3H2,(H5,7,8,9,10,11,12) |
| InChIKey | LETMOHPMBKYRPT-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 122.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|