About N-[3-[bis(2-methylpropyl)amino]propyl]-N',N'-bis(2-methylpropyl)propane-1,3-diamine
N-[3-[bis(2-methylpropyl)amino]propyl]-N',N'-bis(2-methylpropyl)propane-1,3-diamine (PubChem CID 18364435) has the molecular formula C22H49N3
and a molecular weight of 355.66 g/mol. Its IUPAC name is N-[3-[bis(2-methylpropyl)amino]propyl]-N',N'-bis(2-methylpropyl)propane-1,3-diamine.
Molecular Properties
| Compound Name | N-[3-[bis(2-methylpropyl)amino]propyl]-N',N'-bis(2-methylpropyl)propane-1,3-diamine |
| PubChem CID | 18364435 |
| Molecular Formula | C22H49N3 |
| Molecular Weight | 355.66 g/mol |
| Exact Mass | 355.39 |
| IUPAC Name | N-[3-[bis(2-methylpropyl)amino]propyl]-N',N'-bis(2-methylpropyl)propane-1,3-diamine |
| SMILES | CC(C)CN(CCCNCCCN(CC(C)C)CC(C)C)CC(C)C |
| InChI | InChI=1S/C22H49N3/c1-19(2)15-24(16-20(3)4)13-9-11-23-12-10-14-25(17-21(5)6)18-22(7)8/h19-23H,9-18H2,1-8H3 |
| InChIKey | YZVVIHFCOIKFNF-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.66 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[bis(2-methylpropyl)amino]propyl]-N',N'-bis(2-methylpropyl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[bis(2-methylpropyl)amino]propyl]-N',N'-bis(2-methylpropyl)propane-1,3-diamine?
The IUPAC name of N-[3-[bis(2-methylpropyl)amino]propyl]-N',N'-bis(2-methylpropyl)propane-1,3-diamine (CID 18364435) is N-[3-[bis(2-methylpropyl)amino]propyl]-N',N'-bis(2-methylpropyl)propane-1,3-diamine.
What is the SMILES notation for N-[3-[bis(2-methylpropyl)amino]propyl]-N',N'-bis(2-methylpropyl)propane-1,3-diamine?
The canonical SMILES for N-[3-[bis(2-methylpropyl)amino]propyl]-N',N'-bis(2-methylpropyl)propane-1,3-diamine is CC(C)CN(CCCNCCCN(CC(C)C)CC(C)C)CC(C)C.
What is the InChIKey of N-[3-[bis(2-methylpropyl)amino]propyl]-N',N'-bis(2-methylpropyl)propane-1,3-diamine?
The InChIKey is YZVVIHFCOIKFNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H49N3/c1-19(2)15-24(16-20(3)4)13-9-11-23-12-10-14-25(17-21(5)6)18-22(7)8/h19-23H,9-18H2,1-8H3.
What are the key properties of N-[3-[bis(2-methylpropyl)amino]propyl]-N',N'-bis(2-methylpropyl)propane-1,3-diamine?
N-[3-[bis(2-methylpropyl)amino]propyl]-N',N'-bis(2-methylpropyl)propane-1,3-diamine has a molecular weight of 355.66 g/mol, XLogP of 4.58, 16 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[bis(2-methylpropyl)amino]propyl]-N',N'-bis(2-methylpropyl)propane-1,3-diamine is sourced from PubChem (CID 18364435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).