About N-[4-(diethylamino)butyl]-N',N'-diethylbutane-1,4-diamine
N-[4-(diethylamino)butyl]-N',N'-diethylbutane-1,4-diamine (PubChem CID 18364442) has the molecular formula C16H37N3
and a molecular weight of 271.49 g/mol. Its IUPAC name is N-[4-(diethylamino)butyl]-N',N'-diethylbutane-1,4-diamine.
Molecular Properties
| Compound Name | N-[4-(diethylamino)butyl]-N',N'-diethylbutane-1,4-diamine |
| PubChem CID | 18364442 |
| Molecular Formula | C16H37N3 |
| Molecular Weight | 271.49 g/mol |
| Exact Mass | 271.30 |
| IUPAC Name | N-[4-(diethylamino)butyl]-N',N'-diethylbutane-1,4-diamine |
| SMILES | CCN(CC)CCCCNCCCCN(CC)CC |
| InChI | InChI=1S/C16H37N3/c1-5-18(6-2)15-11-9-13-17-14-10-12-16-19(7-3)8-4/h17H,5-16H2,1-4H3 |
| InChIKey | MPSXDPGQUJGYBB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(diethylamino)butyl]-N',N'-diethylbutane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(diethylamino)butyl]-N',N'-diethylbutane-1,4-diamine?
The IUPAC name of N-[4-(diethylamino)butyl]-N',N'-diethylbutane-1,4-diamine (CID 18364442) is N-[4-(diethylamino)butyl]-N',N'-diethylbutane-1,4-diamine.
What is the SMILES notation for N-[4-(diethylamino)butyl]-N',N'-diethylbutane-1,4-diamine?
The canonical SMILES for N-[4-(diethylamino)butyl]-N',N'-diethylbutane-1,4-diamine is CCN(CC)CCCCNCCCCN(CC)CC.
What is the InChIKey of N-[4-(diethylamino)butyl]-N',N'-diethylbutane-1,4-diamine?
The InChIKey is MPSXDPGQUJGYBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H37N3/c1-5-18(6-2)15-11-9-13-17-14-10-12-16-19(7-3)8-4/h17H,5-16H2,1-4H3.
What are the key properties of N-[4-(diethylamino)butyl]-N',N'-diethylbutane-1,4-diamine?
N-[4-(diethylamino)butyl]-N',N'-diethylbutane-1,4-diamine has a molecular weight of 271.49 g/mol, XLogP of 2.82, 14 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(diethylamino)butyl]-N',N'-diethylbutane-1,4-diamine is sourced from PubChem (CID 18364442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).