C16H37N3 — CID 18364444
1-N-(2-aminoethyl)-2-N,2-N,2-tripropylpentane-1,2-diamine (PubChem CID 18364444) has the molecular formula C16H37N3 and a molecular weight of 271.49 g/mol. Its IUPAC name is 1-N-(2-aminoethyl)-2-N,2-N,2-tripropylpentane-1,2-diamine.
| Compound Name | 1-N-(2-aminoethyl)-2-N,2-N,2-tripropylpentane-1,2-diamine |
|---|---|
| PubChem CID | 18364444 |
| Molecular Formula | C16H37N3 |
| Molecular Weight | 271.49 g/mol |
| Exact Mass | 271.30 |
| IUPAC Name | 1-N-(2-aminoethyl)-2-N,2-N,2-tripropylpentane-1,2-diamine |
| SMILES | CCCN(CCC)C(CCC)(CCC)CNCCN |
| InChI | InChI=1S/C16H37N3/c1-5-9-16(10-6-2,15-18-12-11-17)19(13-7-3)14-8-4/h18H,5-15,17H2,1-4H3 |
| InChIKey | WFZCKNIVTBCOGK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.49 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|