About 2,2,3-trimethyl-3-(2,3,3-trimethylbutan-2-yloxy)butane
2,2,3-trimethyl-3-(2,3,3-trimethylbutan-2-yloxy)butane (PubChem CID 18364477) has the molecular formula C14H30O
and a molecular weight of 214.39 g/mol. Its IUPAC name is 2,2,3-trimethyl-3-(2,3,3-trimethylbutan-2-yloxy)butane.
Analyze 2,2,3-trimethyl-3-(2,3,3-trimethylbutan-2-yloxy)butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,3-trimethyl-3-(2,3,3-trimethylbutan-2-yloxy)butane?
The IUPAC name of 2,2,3-trimethyl-3-(2,3,3-trimethylbutan-2-yloxy)butane (CID 18364477) is 2,2,3-trimethyl-3-(2,3,3-trimethylbutan-2-yloxy)butane.
What is the SMILES notation for 2,2,3-trimethyl-3-(2,3,3-trimethylbutan-2-yloxy)butane?
The canonical SMILES for 2,2,3-trimethyl-3-(2,3,3-trimethylbutan-2-yloxy)butane is CC(C)(C)C(C)(C)OC(C)(C)C(C)(C)C.
What is the InChIKey of 2,2,3-trimethyl-3-(2,3,3-trimethylbutan-2-yloxy)butane?
The InChIKey is KCPDPHFRMNMEKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30O/c1-11(2,3)13(7,8)15-14(9,10)12(4,5)6/h1-10H3.
What are the key properties of 2,2,3-trimethyl-3-(2,3,3-trimethylbutan-2-yloxy)butane?
2,2,3-trimethyl-3-(2,3,3-trimethylbutan-2-yloxy)butane has a molecular weight of 214.39 g/mol, XLogP of 4.65, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,3-trimethyl-3-(2,3,3-trimethylbutan-2-yloxy)butane is sourced from PubChem (CID 18364477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).