About 4-methyl-2-piperazin-1-ylpyrimidine;dihydrochloride
4-methyl-2-piperazin-1-ylpyrimidine;dihydrochloride (PubChem CID 18364978) has the molecular formula C9H16Cl2N4
and a molecular weight of 251.16 g/mol. Its IUPAC name is 4-methyl-2-piperazin-1-ylpyrimidine;dihydrochloride.
Molecular Properties
| Compound Name | 4-methyl-2-piperazin-1-ylpyrimidine;dihydrochloride |
| PubChem CID | 18364978 |
| Molecular Formula | C9H16Cl2N4 |
| Molecular Weight | 251.16 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 4-methyl-2-piperazin-1-ylpyrimidine;dihydrochloride |
| SMILES | Cc1ccnc(N2CCNCC2)n1.Cl.Cl |
| InChI | InChI=1S/C9H14N4.2ClH/c1-8-2-3-11-9(12-8)13-6-4-10-5-7-13;;/h2-3,10H,4-7H2,1H3;2*1H |
| InChIKey | TXBXJZSWIGNZPA-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.16 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methyl-2-piperazin-1-ylpyrimidine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-piperazin-1-ylpyrimidine;dihydrochloride?
The IUPAC name of 4-methyl-2-piperazin-1-ylpyrimidine;dihydrochloride (CID 18364978) is 4-methyl-2-piperazin-1-ylpyrimidine;dihydrochloride.
What is the SMILES notation for 4-methyl-2-piperazin-1-ylpyrimidine;dihydrochloride?
The canonical SMILES for 4-methyl-2-piperazin-1-ylpyrimidine;dihydrochloride is Cc1ccnc(N2CCNCC2)n1.Cl.Cl.
What is the InChIKey of 4-methyl-2-piperazin-1-ylpyrimidine;dihydrochloride?
The InChIKey is TXBXJZSWIGNZPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4.2ClH/c1-8-2-3-11-9(12-8)13-6-4-10-5-7-13;;/h2-3,10H,4-7H2,1H3;2*1H.
What are the key properties of 4-methyl-2-piperazin-1-ylpyrimidine;dihydrochloride?
4-methyl-2-piperazin-1-ylpyrimidine;dihydrochloride has a molecular weight of 251.16 g/mol, XLogP of 1.04, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-piperazin-1-ylpyrimidine;dihydrochloride is sourced from PubChem (CID 18364978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).