C22H31N7O6 — CID 18364979
(E)-but-2-enedioic acid;5-[4-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]butoxy]-2-methyl-1,2,4-triazin-3-one (PubChem CID 18364979) has the molecular formula C22H31N7O6 and a molecular weight of 489.53 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;5-[4-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]butoxy]-2-methyl-1,2,4-triazin-3-one.
| Compound Name | (E)-but-2-enedioic acid;5-[4-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]butoxy]-2-methyl-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 18364979 |
| Molecular Formula | C22H31N7O6 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | (E)-but-2-enedioic acid;5-[4-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]butoxy]-2-methyl-1,2,4-triazin-3-one |
| SMILES | Cc1cc(C)nc(N2CCN(CCCCOc3cnn(C)c(=O)n3)CC2)n1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C18H27N7O2.C4H4O4/c1-14-12-15(2)21-17(20-14)25-9-7-24(8-10-25)6-4-5-11-27-16-13-19-23(3)18(26)22-16;5-3(6)1-2-4(7)8/h12-13H,4-11H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | DEQOINSAKUFYGV-WLHGVMLRSA-N |
| XLogP | 0.28 |
| TPSA | 163.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|