About [6-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)naphthalen-2-yl] trifluoromethanesulfonate
[6-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)naphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 18365320) has the molecular formula C23H20F3NO3S
and a molecular weight of 447.48 g/mol. Its IUPAC name is [6-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)naphthalen-2-yl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [6-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)naphthalen-2-yl] trifluoromethanesulfonate |
| PubChem CID | 18365320 |
| Molecular Formula | C23H20F3NO3S |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | [6-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)naphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc2cc(C3=CCN(Cc4ccccc4)CC3)ccc2c1)C(F)(F)F |
| InChI | InChI=1S/C23H20F3NO3S/c24-23(25,26)31(28,29)30-22-9-8-20-14-19(6-7-21(20)15-22)18-10-12-27(13-11-18)16-17-4-2-1-3-5-17/h1-10,14-15H,11-13,16H2 |
| InChIKey | WKRYUCDGTWKGMY-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [6-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)naphthalen-2-yl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)naphthalen-2-yl] trifluoromethanesulfonate?
The IUPAC name of [6-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)naphthalen-2-yl] trifluoromethanesulfonate (CID 18365320) is [6-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)naphthalen-2-yl] trifluoromethanesulfonate.
What is the SMILES notation for [6-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)naphthalen-2-yl] trifluoromethanesulfonate?
The canonical SMILES for [6-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)naphthalen-2-yl] trifluoromethanesulfonate is O=S(=O)(Oc1ccc2cc(C3=CCN(Cc4ccccc4)CC3)ccc2c1)C(F)(F)F.
What is the InChIKey of [6-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)naphthalen-2-yl] trifluoromethanesulfonate?
The InChIKey is WKRYUCDGTWKGMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20F3NO3S/c24-23(25,26)31(28,29)30-22-9-8-20-14-19(6-7-21(20)15-22)18-10-12-27(13-11-18)16-17-4-2-1-3-5-17/h1-10,14-15H,11-13,16H2.
What are the key properties of [6-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)naphthalen-2-yl] trifluoromethanesulfonate?
[6-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)naphthalen-2-yl] trifluoromethanesulfonate has a molecular weight of 447.48 g/mol, XLogP of 5.36, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)naphthalen-2-yl] trifluoromethanesulfonate is sourced from PubChem (CID 18365320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).