C37H43N3O — CID 18365536
N,N-diethyl-4-[3',3',4',7'-tetramethyl-1'-(2-methylpropyl)spiro[benzo[h][1,4]benzoxazine-2,2'-indole]-6-yl]aniline (PubChem CID 18365536) has the molecular formula C37H43N3O and a molecular weight of 545.77 g/mol. Its IUPAC name is N,N-diethyl-4-[3',3',4',7'-tetramethyl-1'-(2-methylpropyl)spiro[benzo[h][1,4]benzoxazine-2,2'-indole]-6-yl]aniline.
| Compound Name | N,N-diethyl-4-[3',3',4',7'-tetramethyl-1'-(2-methylpropyl)spiro[benzo[h][1,4]benzoxazine-2,2'-indole]-6-yl]aniline |
|---|---|
| PubChem CID | 18365536 |
| Molecular Formula | C37H43N3O |
| Molecular Weight | 545.77 g/mol |
| Exact Mass | 545.34 |
| IUPAC Name | N,N-diethyl-4-[3',3',4',7'-tetramethyl-1'-(2-methylpropyl)spiro[benzo[h][1,4]benzoxazine-2,2'-indole]-6-yl]aniline |
| SMILES | CCN(CC)c1ccc(-c2cc3c(c4ccccc24)OC2(C=N3)N(CC(C)C)c3c(C)ccc(C)c3C2(C)C)cc1 |
| InChI | InChI=1S/C37H43N3O/c1-9-39(10-2)28-19-17-27(18-20-28)31-21-32-35(30-14-12-11-13-29(30)31)41-37(23-38-32)36(7,8)33-25(5)15-16-26(6)34(33)40(37)22-24(3)4/h11-21,23-24H,9-10,22H2,1-8H3 |
| InChIKey | JXZLMGBXTFHQDO-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.77 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |