About bis(4-amino-2,3,5,6-tetrafluorophenyl)methanone
bis(4-amino-2,3,5,6-tetrafluorophenyl)methanone (PubChem CID 18365778) has the molecular formula C13H4F8N2O
and a molecular weight of 356.17 g/mol. Its IUPAC name is bis(4-amino-2,3,5,6-tetrafluorophenyl)methanone.
Molecular Properties
| Compound Name | bis(4-amino-2,3,5,6-tetrafluorophenyl)methanone |
| PubChem CID | 18365778 |
| Molecular Formula | C13H4F8N2O |
| Molecular Weight | 356.17 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | bis(4-amino-2,3,5,6-tetrafluorophenyl)methanone |
| SMILES | Nc1c(F)c(F)c(C(=O)c2c(F)c(F)c(N)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C13H4F8N2O/c14-3-1(4(15)8(19)11(22)7(3)18)13(24)2-5(16)9(20)12(23)10(21)6(2)17/h22-23H2 |
| InChIKey | WCIQLLFUGPIURI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.17 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze bis(4-amino-2,3,5,6-tetrafluorophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-amino-2,3,5,6-tetrafluorophenyl)methanone?
The IUPAC name of bis(4-amino-2,3,5,6-tetrafluorophenyl)methanone (CID 18365778) is bis(4-amino-2,3,5,6-tetrafluorophenyl)methanone.
What is the SMILES notation for bis(4-amino-2,3,5,6-tetrafluorophenyl)methanone?
The canonical SMILES for bis(4-amino-2,3,5,6-tetrafluorophenyl)methanone is Nc1c(F)c(F)c(C(=O)c2c(F)c(F)c(N)c(F)c2F)c(F)c1F.
What is the InChIKey of bis(4-amino-2,3,5,6-tetrafluorophenyl)methanone?
The InChIKey is WCIQLLFUGPIURI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H4F8N2O/c14-3-1(4(15)8(19)11(22)7(3)18)13(24)2-5(16)9(20)12(23)10(21)6(2)17/h22-23H2.
What are the key properties of bis(4-amino-2,3,5,6-tetrafluorophenyl)methanone?
bis(4-amino-2,3,5,6-tetrafluorophenyl)methanone has a molecular weight of 356.17 g/mol, XLogP of 3.19, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-amino-2,3,5,6-tetrafluorophenyl)methanone is sourced from PubChem (CID 18365778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).