C15H4Cl6F8N2 — CID 18365782
4-[2-(4-amino-2,3,5,6-tetrafluorophenyl)-1,1,1,3,3,3-hexachloropropan-2-yl]-2,3,5,6-tetrafluoroaniline (PubChem CID 18365782) has the molecular formula C15H4Cl6F8N2 and a molecular weight of 576.91 g/mol. Its IUPAC name is 4-[2-(4-amino-2,3,5,6-tetrafluorophenyl)-1,1,1,3,3,3-hexachloropropan-2-yl]-2,3,5,6-tetrafluoroaniline.
| Compound Name | 4-[2-(4-amino-2,3,5,6-tetrafluorophenyl)-1,1,1,3,3,3-hexachloropropan-2-yl]-2,3,5,6-tetrafluoroaniline |
|---|---|
| PubChem CID | 18365782 |
| Molecular Formula | C15H4Cl6F8N2 |
| Molecular Weight | 576.91 g/mol |
| Exact Mass | 573.84 |
| IUPAC Name | 4-[2-(4-amino-2,3,5,6-tetrafluorophenyl)-1,1,1,3,3,3-hexachloropropan-2-yl]-2,3,5,6-tetrafluoroaniline |
| SMILES | Nc1c(F)c(F)c(C(c2c(F)c(F)c(N)c(F)c2F)(C(Cl)(Cl)Cl)C(Cl)(Cl)Cl)c(F)c1F |
| InChI | InChI=1S/C15H4Cl6F8N2/c16-14(17,18)13(15(19,20)21,1-3(22)7(26)11(30)8(27)4(1)23)2-5(24)9(28)12(31)10(29)6(2)25/h30-31H2 |
| InChIKey | BAXFVDUYPXJNRF-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.91 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|