C6H4F4N2 — CID 18365815
1-N,1-N,2-N,2-N-tetrafluorobenzene-1,2-diamine (PubChem CID 18365815) has the molecular formula C6H4F4N2 and a molecular weight of 180.10 g/mol. Its IUPAC name is 1-N,1-N,2-N,2-N-tetrafluorobenzene-1,2-diamine.
| Compound Name | 1-N,1-N,2-N,2-N-tetrafluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 18365815 |
| Molecular Formula | C6H4F4N2 |
| Molecular Weight | 180.10 g/mol |
| Exact Mass | 180.03 |
| IUPAC Name | 1-N,1-N,2-N,2-N-tetrafluorobenzene-1,2-diamine |
| SMILES | FN(F)c1ccccc1N(F)F |
| InChI | InChI=1S/C6H4F4N2/c7-11(8)5-3-1-2-4-6(5)12(9)10/h1-4H |
| InChIKey | DCTFCVYVHBHICU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.10 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|