About 5-methyl-1,2-oxazole-4-carboxamide
5-methyl-1,2-oxazole-4-carboxamide (PubChem CID 18366019) has the molecular formula C5H6N2O2
and a molecular weight of 126.11 g/mol. Its IUPAC name is 5-methyl-1,2-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-methyl-1,2-oxazole-4-carboxamide |
| PubChem CID | 18366019 |
| Molecular Formula | C5H6N2O2 |
| Molecular Weight | 126.11 g/mol |
| Exact Mass | 126.04 |
| IUPAC Name | 5-methyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1oncc1C(N)=O |
| InChI | InChI=1S/C5H6N2O2/c1-3-4(5(6)8)2-7-9-3/h2H,1H3,(H2,6,8) |
| InChIKey | RRGRQQFUASVDPO-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.11 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-1,2-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1,2-oxazole-4-carboxamide?
The IUPAC name of 5-methyl-1,2-oxazole-4-carboxamide (CID 18366019) is 5-methyl-1,2-oxazole-4-carboxamide.
What is the SMILES notation for 5-methyl-1,2-oxazole-4-carboxamide?
The canonical SMILES for 5-methyl-1,2-oxazole-4-carboxamide is Cc1oncc1C(N)=O.
What is the InChIKey of 5-methyl-1,2-oxazole-4-carboxamide?
The InChIKey is RRGRQQFUASVDPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O2/c1-3-4(5(6)8)2-7-9-3/h2H,1H3,(H2,6,8).
What are the key properties of 5-methyl-1,2-oxazole-4-carboxamide?
5-methyl-1,2-oxazole-4-carboxamide has a molecular weight of 126.11 g/mol, XLogP of 0.08, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1,2-oxazole-4-carboxamide is sourced from PubChem (CID 18366019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).