C14H22 — CID 18366163
1,2,3,6,7-pentamethyl-2,3,4,5-tetrahydro-1H-indene (PubChem CID 18366163) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is 1,2,3,6,7-pentamethyl-2,3,4,5-tetrahydro-1H-indene.
| Compound Name | 1,2,3,6,7-pentamethyl-2,3,4,5-tetrahydro-1H-indene |
|---|---|
| PubChem CID | 18366163 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | 1,2,3,6,7-pentamethyl-2,3,4,5-tetrahydro-1H-indene |
| SMILES | CC1=C(C)C2=C(CC1)C(C)C(C)C2C |
| InChI | InChI=1S/C14H22/c1-8-6-7-13-11(4)10(3)12(5)14(13)9(8)2/h10-12H,6-7H2,1-5H3 |
| InChIKey | LOBGELDKWRUZPS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |