C40H83O4P — CID 18366357
(10,14-diheptyl-12-propyltricosan-12-yl) dihydrogen phosphate (PubChem CID 18366357) has the molecular formula C40H83O4P and a molecular weight of 659.07 g/mol. Its IUPAC name is (10,14-diheptyl-12-propyltricosan-12-yl) dihydrogen phosphate.
| Compound Name | (10,14-diheptyl-12-propyltricosan-12-yl) dihydrogen phosphate |
|---|---|
| PubChem CID | 18366357 |
| Molecular Formula | C40H83O4P |
| Molecular Weight | 659.07 g/mol |
| Exact Mass | 658.60 |
| IUPAC Name | (10,14-diheptyl-12-propyltricosan-12-yl) dihydrogen phosphate |
| SMILES | CCCCCCCCCC(CCCCCCC)CC(CCC)(CC(CCCCCCC)CCCCCCCCC)OP(=O)(O)O |
| InChI | InChI=1S/C40H83O4P/c1-6-11-15-19-21-25-29-33-38(31-27-23-17-13-8-3)36-40(35-10-5,44-45(41,42)43)37-39(32-28-24-18-14-9-4)34-30-26-22-20-16-12-7-2/h38-39H,6-37H2,1-5H3,(H2,41,42,43) |
| InChIKey | QOFPRYXPAPWCGL-UHFFFAOYSA-N |
| XLogP | 14.65 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.07 |
| LogP ≤ 5 | 14.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|