C10H20N8 — CID 18366387
2-(2,6-diamino-3-cyclohexyl-2H-1,3,5-triazin-4-yl)guanidine (PubChem CID 18366387) has the molecular formula C10H20N8 and a molecular weight of 252.33 g/mol. Its IUPAC name is 2-(2,6-diamino-3-cyclohexyl-2H-1,3,5-triazin-4-yl)guanidine.
| Compound Name | 2-(2,6-diamino-3-cyclohexyl-2H-1,3,5-triazin-4-yl)guanidine |
|---|---|
| PubChem CID | 18366387 |
| Molecular Formula | C10H20N8 |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 2-(2,6-diamino-3-cyclohexyl-2H-1,3,5-triazin-4-yl)guanidine |
| SMILES | NC(N)=NC1=NC(N)=NC(N)N1C1CCCCC1 |
| InChI | InChI=1S/C10H20N8/c11-7(12)15-10-17-8(13)16-9(14)18(10)6-4-2-1-3-5-6/h6,9H,1-5,14H2,(H6,11,12,13,15,16,17) |
| InChIKey | XQOCWNRONBSGHL-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 144.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|